C17H18Cl2O — CID 152534426
4-chloro-4-(6-chloro-6-methoxycyclohexa-2,4-dien-1-yl)-2,3-dihydro-1H-naphthalene (PubChem CID 152534426) has the molecular formula C17H18Cl2O and a molecular weight of 309.24 g/mol. Its IUPAC name is 4-chloro-4-(6-chloro-6-methoxycyclohexa-2,4-dien-1-yl)-2,3-dihydro-1H-naphthalene.
| Compound Name | 4-chloro-4-(6-chloro-6-methoxycyclohexa-2,4-dien-1-yl)-2,3-dihydro-1H-naphthalene |
|---|---|
| PubChem CID | 152534426 |
| Molecular Formula | C17H18Cl2O |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 4-chloro-4-(6-chloro-6-methoxycyclohexa-2,4-dien-1-yl)-2,3-dihydro-1H-naphthalene |
| SMILES | COC1(Cl)C=CC=CC1C1(Cl)CCCc2ccccc21 |
| InChI | InChI=1S/C17H18Cl2O/c1-20-17(19)12-5-4-10-15(17)16(18)11-6-8-13-7-2-3-9-14(13)16/h2-5,7,9-10,12,15H,6,8,11H2,1H3 |
| InChIKey | YKFGSGJNEQQYBT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|