C16H23N — CID 15657719
N,N-dimethyl-2,3,4,9,10,10a-hexahydro-1H-phenanthren-4a-amine (PubChem CID 15657719) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is N,N-dimethyl-2,3,4,9,10,10a-hexahydro-1H-phenanthren-4a-amine.
| Compound Name | N,N-dimethyl-2,3,4,9,10,10a-hexahydro-1H-phenanthren-4a-amine |
|---|---|
| PubChem CID | 15657719 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | N,N-dimethyl-2,3,4,9,10,10a-hexahydro-1H-phenanthren-4a-amine |
| SMILES | CN(C)C12CCCCC1CCc1ccccc12 |
| InChI | InChI=1S/C16H23N/c1-17(2)16-12-6-5-8-14(16)11-10-13-7-3-4-9-15(13)16/h3-4,7,9,14H,5-6,8,10-12H2,1-2H3 |
| InChIKey | CRRGPBAEOBRTMN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |