C15H22O — CID 176704154
(1,1-diethyl-3,4-dihydro-2H-naphthalen-2-yl)methanol (PubChem CID 176704154) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (1,1-diethyl-3,4-dihydro-2H-naphthalen-2-yl)methanol.
| Compound Name | (1,1-diethyl-3,4-dihydro-2H-naphthalen-2-yl)methanol |
|---|---|
| PubChem CID | 176704154 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (1,1-diethyl-3,4-dihydro-2H-naphthalen-2-yl)methanol |
| SMILES | CCC1(CC)c2ccccc2CCC1CO |
| InChI | InChI=1S/C15H22O/c1-3-15(4-2)13(11-16)10-9-12-7-5-6-8-14(12)15/h5-8,13,16H,3-4,9-11H2,1-2H3 |
| InChIKey | OSDQOXCYGHEEGB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |