C15H21N — CID 15555065
4,10b-dimethyl-1,2,3,4a,5,6-hexahydrobenzo[f]quinoline (PubChem CID 15555065) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 4,10b-dimethyl-1,2,3,4a,5,6-hexahydrobenzo[f]quinoline.
| Compound Name | 4,10b-dimethyl-1,2,3,4a,5,6-hexahydrobenzo[f]quinoline |
|---|---|
| PubChem CID | 15555065 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 4,10b-dimethyl-1,2,3,4a,5,6-hexahydrobenzo[f]quinoline |
| SMILES | CN1CCCC2(C)c3ccccc3CCC12 |
| InChI | InChI=1S/C15H21N/c1-15-10-5-11-16(2)14(15)9-8-12-6-3-4-7-13(12)15/h3-4,6-7,14H,5,8-11H2,1-2H3 |
| InChIKey | DMAVPELBUCMLHN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |