C17H22 — CID 123682329
1,1,4a-trimethyl-4,9,10,10a-tetrahydrophenanthrene (PubChem CID 123682329) has the molecular formula C17H22 and a molecular weight of 226.36 g/mol. Its IUPAC name is 1,1,4a-trimethyl-4,9,10,10a-tetrahydrophenanthrene.
| Compound Name | 1,1,4a-trimethyl-4,9,10,10a-tetrahydrophenanthrene |
|---|---|
| PubChem CID | 123682329 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1,1,4a-trimethyl-4,9,10,10a-tetrahydrophenanthrene |
| SMILES | CC1(C)C=CCC2(C)c3ccccc3CCC12 |
| InChI | InChI=1S/C17H22/c1-16(2)11-6-12-17(3)14-8-5-4-7-13(14)9-10-15(16)17/h4-8,11,15H,9-10,12H2,1-3H3 |
| InChIKey | CFYFMSAIZYUODF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|