C26H26O — CID 142475674
(1'S,2S,10'R,11'R)-1',11'-dimethyl-3-methylidenespiro[1-benzofuran-2,13'-tetracyclo[8.6.0.02,7.011,14]hexadeca-2,4,6,14-tetraene] (PubChem CID 142475674) has the molecular formula C26H26O and a molecular weight of 354.49 g/mol. Its IUPAC name is (1'S,2S,10'R,11'R)-1',11'-dimethyl-3-methylidenespiro[1-benzofuran-2,13'-tetracyclo[8.6.0.02,7.011,14]hexadeca-2,4,6,14-tetraene].
| Compound Name | (1'S,2S,10'R,11'R)-1',11'-dimethyl-3-methylidenespiro[1-benzofuran-2,13'-tetracyclo[8.6.0.02,7.011,14]hexadeca-2,4,6,14-tetraene] |
|---|---|
| PubChem CID | 142475674 |
| Molecular Formula | C26H26O |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | (1'S,2S,10'R,11'R)-1',11'-dimethyl-3-methylidenespiro[1-benzofuran-2,13'-tetracyclo[8.6.0.02,7.011,14]hexadeca-2,4,6,14-tetraene] |
| SMILES | C=C1c2ccccc2O[C@@]12C[C@@]1(C)C2=CC[C@]2(C)c3ccccc3CC[C@@H]12 |
| InChI | InChI=1S/C26H26O/c1-17-19-9-5-7-11-21(19)27-26(17)16-25(3)22-13-12-18-8-4-6-10-20(18)24(22,2)15-14-23(25)26/h4-11,14,22H,1,12-13,15-16H2,2-3H3/t22-,24-,25-,26+/m1/s1 |
| InChIKey | NRLUVQDAVCVHCX-RCOXAODPSA-N |
| XLogP | 6.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|