C11H10O3 — CID 86339718
(2R)-2-methyl-3-methylidene-1-benzofuran-2-carboxylic acid (PubChem CID 86339718) has the molecular formula C11H10O3 and a molecular weight of 190.20 g/mol. Its IUPAC name is (2R)-2-methyl-3-methylidene-1-benzofuran-2-carboxylic acid.
| Compound Name | (2R)-2-methyl-3-methylidene-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 86339718 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | (2R)-2-methyl-3-methylidene-1-benzofuran-2-carboxylic acid |
| SMILES | C=C1c2ccccc2O[C@@]1(C)C(=O)O |
| InChI | InChI=1S/C11H10O3/c1-7-8-5-3-4-6-9(8)14-11(7,2)10(12)13/h3-6H,1H2,2H3,(H,12,13)/t11-/m1/s1 |
| InChIKey | GUTFWRLPAIAIAM-LLVKDONJSA-N |
| XLogP | 1.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |