C17H26O2 — CID 91394959
1-(2,2-dimethylchromen-4-yl)ethanone;ethane (PubChem CID 91394959) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 1-(2,2-dimethylchromen-4-yl)ethanone;ethane.
| Compound Name | 1-(2,2-dimethylchromen-4-yl)ethanone;ethane |
|---|---|
| PubChem CID | 91394959 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 1-(2,2-dimethylchromen-4-yl)ethanone;ethane |
| SMILES | CC.CC.CC(=O)C1=CC(C)(C)Oc2ccccc21 |
| InChI | InChI=1S/C13H14O2.2C2H6/c1-9(14)11-8-13(2,3)15-12-7-5-4-6-10(11)12;2*1-2/h4-8H,1-3H3;2*1-2H3 |
| InChIKey | RRGYQPGGAMBMRR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |