C19H25NO2 — CID 10236502
(2E)-2-(2,2-dimethyl-3H-1,3-benzoxazin-4-ylidene)-1-(2-methylcyclohexyl)ethanone (PubChem CID 10236502) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is (2E)-2-(2,2-dimethyl-3H-1,3-benzoxazin-4-ylidene)-1-(2-methylcyclohexyl)ethanone.
| Compound Name | (2E)-2-(2,2-dimethyl-3H-1,3-benzoxazin-4-ylidene)-1-(2-methylcyclohexyl)ethanone |
|---|---|
| PubChem CID | 10236502 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (2E)-2-(2,2-dimethyl-3H-1,3-benzoxazin-4-ylidene)-1-(2-methylcyclohexyl)ethanone |
| SMILES | CC1CCCCC1C(=O)/C=C1/NC(C)(C)Oc2ccccc21 |
| InChI | InChI=1S/C19H25NO2/c1-13-8-4-5-9-14(13)17(21)12-16-15-10-6-7-11-18(15)22-19(2,3)20-16/h6-7,10-14,20H,4-5,8-9H2,1-3H3/b16-12+ |
| InChIKey | GNCLHVMCCFQGDC-FOWTUZBSSA-N |
| XLogP | 4.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|