C19H22F3NO2 — CID 10286847
(2E)-2-(2,2-dimethyl-3H-1,3-benzoxazin-4-ylidene)-1-[3-(trifluoromethyl)cyclohexyl]ethanone (PubChem CID 10286847) has the molecular formula C19H22F3NO2 and a molecular weight of 353.38 g/mol. Its IUPAC name is (2E)-2-(2,2-dimethyl-3H-1,3-benzoxazin-4-ylidene)-1-[3-(trifluoromethyl)cyclohexyl]ethanone.
| Compound Name | (2E)-2-(2,2-dimethyl-3H-1,3-benzoxazin-4-ylidene)-1-[3-(trifluoromethyl)cyclohexyl]ethanone |
|---|---|
| PubChem CID | 10286847 |
| Molecular Formula | C19H22F3NO2 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (2E)-2-(2,2-dimethyl-3H-1,3-benzoxazin-4-ylidene)-1-[3-(trifluoromethyl)cyclohexyl]ethanone |
| SMILES | CC1(C)N/C(=C/C(=O)C2CCCC(C(F)(F)F)C2)c2ccccc2O1 |
| InChI | InChI=1S/C19H22F3NO2/c1-18(2)23-15(14-8-3-4-9-17(14)25-18)11-16(24)12-6-5-7-13(10-12)19(20,21)22/h3-4,8-9,11-13,23H,5-7,10H2,1-2H3/b15-11+ |
| InChIKey | PWUKQECXRYSSOY-RVDMUPIBSA-N |
| XLogP | 4.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|