C19H19NO2S — CID 10286546
(2E)-2-(2,2-dimethyl-3H-1,3-benzoxazin-4-ylidene)-1-(2-methylsulfanylphenyl)ethanone (PubChem CID 10286546) has the molecular formula C19H19NO2S and a molecular weight of 325.43 g/mol. Its IUPAC name is (2E)-2-(2,2-dimethyl-3H-1,3-benzoxazin-4-ylidene)-1-(2-methylsulfanylphenyl)ethanone.
| Compound Name | (2E)-2-(2,2-dimethyl-3H-1,3-benzoxazin-4-ylidene)-1-(2-methylsulfanylphenyl)ethanone |
|---|---|
| PubChem CID | 10286546 |
| Molecular Formula | C19H19NO2S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | (2E)-2-(2,2-dimethyl-3H-1,3-benzoxazin-4-ylidene)-1-(2-methylsulfanylphenyl)ethanone |
| SMILES | CSc1ccccc1C(=O)/C=C1/NC(C)(C)Oc2ccccc21 |
| InChI | InChI=1S/C19H19NO2S/c1-19(2)20-15(13-8-4-6-10-17(13)22-19)12-16(21)14-9-5-7-11-18(14)23-3/h4-12,20H,1-3H3/b15-12+ |
| InChIKey | RJKKXVMPXBTNBL-NTCAYCPXSA-N |
| XLogP | 4.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|