C14H14F4O2 — CID 86998620
(2-fluorophenyl) 3-(trifluoromethyl)cyclohexane-1-carboxylate (PubChem CID 86998620) has the molecular formula C14H14F4O2 and a molecular weight of 290.26 g/mol. Its IUPAC name is (2-fluorophenyl) 3-(trifluoromethyl)cyclohexane-1-carboxylate.
| Compound Name | (2-fluorophenyl) 3-(trifluoromethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 86998620 |
| Molecular Formula | C14H14F4O2 |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (2-fluorophenyl) 3-(trifluoromethyl)cyclohexane-1-carboxylate |
| SMILES | O=C(Oc1ccccc1F)C1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C14H14F4O2/c15-11-6-1-2-7-12(11)20-13(19)9-4-3-5-10(8-9)14(16,17)18/h1-2,6-7,9-10H,3-5,8H2 |
| InChIKey | SAXYYQZCLXPKGJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|