C20H26 — CID 90729178
(8S,9R,13S,14S)-9-ethenyl-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene (PubChem CID 90729178) has the molecular formula C20H26 and a molecular weight of 266.43 g/mol. Its IUPAC name is (8S,9R,13S,14S)-9-ethenyl-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene.
| Compound Name | (8S,9R,13S,14S)-9-ethenyl-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 90729178 |
| Molecular Formula | C20H26 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | (8S,9R,13S,14S)-9-ethenyl-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene |
| SMILES | C=C[C@]12CC[C@]3(C)CCC[C@H]3[C@@H]1CCc1ccccc12 |
| InChI | InChI=1S/C20H26/c1-3-20-14-13-19(2)12-6-9-17(19)18(20)11-10-15-7-4-5-8-16(15)20/h3-5,7-8,17-18H,1,6,9-14H2,2H3/t17-,18-,19-,20+/m0/s1 |
| InChIKey | QEDIXLRYHXDWBW-LWYYNNOASA-N |
| XLogP | 5.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|