C22H27NO2S — CID 138969893
N-[(1S,10aS)-4a-methyl-2,3,4,9,10,10a-hexahydro-1H-phenanthren-1-yl]-4-methylbenzenesulfonamide (PubChem CID 138969893) has the molecular formula C22H27NO2S and a molecular weight of 369.53 g/mol. Its IUPAC name is N-[(1S,10aS)-4a-methyl-2,3,4,9,10,10a-hexahydro-1H-phenanthren-1-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1S,10aS)-4a-methyl-2,3,4,9,10,10a-hexahydro-1H-phenanthren-1-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 138969893 |
| Molecular Formula | C22H27NO2S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | N-[(1S,10aS)-4a-methyl-2,3,4,9,10,10a-hexahydro-1H-phenanthren-1-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H]2CCCC3(C)c4ccccc4CC[C@H]23)cc1 |
| InChI | InChI=1S/C22H27NO2S/c1-16-9-12-18(13-10-16)26(24,25)23-21-8-5-15-22(2)19-7-4-3-6-17(19)11-14-20(21)22/h3-4,6-7,9-10,12-13,20-21,23H,5,8,11,14-15H2,1-2H3/t20-,21+,22?/m1/s1 |
| InChIKey | SAIDRUGCICCVLA-LKXRKSRJSA-N |
| XLogP | 4.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |