C16H20N2O4S — CID 158606883
N-(1-hydroxy-2,3-dihydroinden-1-yl)-4-methylbenzenesulfonamide;hydroxylamine (PubChem CID 158606883) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is N-(1-hydroxy-2,3-dihydroinden-1-yl)-4-methylbenzenesulfonamide;hydroxylamine.
| Compound Name | N-(1-hydroxy-2,3-dihydroinden-1-yl)-4-methylbenzenesulfonamide;hydroxylamine |
|---|---|
| PubChem CID | 158606883 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-(1-hydroxy-2,3-dihydroinden-1-yl)-4-methylbenzenesulfonamide;hydroxylamine |
| SMILES | Cc1ccc(S(=O)(=O)NC2(O)CCc3ccccc32)cc1.NO |
| InChI | InChI=1S/C16H17NO3S.H3NO/c1-12-6-8-14(9-7-12)21(19,20)17-16(18)11-10-13-4-2-3-5-15(13)16;1-2/h2-9,17-18H,10-11H2,1H3;2H,1H2 |
| InChIKey | HWIJLSDYBKRDDJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|