About N-[(1R)-1-hydroxy-2,3-dihydroinden-1-yl]-N,4-dimethylbenzenesulfonamide
N-[(1R)-1-hydroxy-2,3-dihydroinden-1-yl]-N,4-dimethylbenzenesulfonamide (PubChem CID 70267678) has the molecular formula C17H19NO3S
and a molecular weight of 317.41 g/mol. Its IUPAC name is N-[(1R)-1-hydroxy-2,3-dihydroinden-1-yl]-N,4-dimethylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-[(1R)-1-hydroxy-2,3-dihydroinden-1-yl]-N,4-dimethylbenzenesulfonamide |
| PubChem CID | 70267678 |
| Molecular Formula | C17H19NO3S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | N-[(1R)-1-hydroxy-2,3-dihydroinden-1-yl]-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)[C@@]2(O)CCc3ccccc32)cc1 |
| InChI | InChI=1S/C17H19NO3S/c1-13-7-9-15(10-8-13)22(20,21)18(2)17(19)12-11-14-5-3-4-6-16(14)17/h3-10,19H,11-12H2,1-2H3/t17-/m1/s1 |
| InChIKey | DFMLVELOQNPSLS-QGZVFWFLSA-N |
| XLogP | 2.41 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[(1R)-1-hydroxy-2,3-dihydroinden-1-yl]-N,4-dimethylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-1-hydroxy-2,3-dihydroinden-1-yl]-N,4-dimethylbenzenesulfonamide?
The IUPAC name of N-[(1R)-1-hydroxy-2,3-dihydroinden-1-yl]-N,4-dimethylbenzenesulfonamide (CID 70267678) is N-[(1R)-1-hydroxy-2,3-dihydroinden-1-yl]-N,4-dimethylbenzenesulfonamide.
What is the SMILES notation for N-[(1R)-1-hydroxy-2,3-dihydroinden-1-yl]-N,4-dimethylbenzenesulfonamide?
The canonical SMILES for N-[(1R)-1-hydroxy-2,3-dihydroinden-1-yl]-N,4-dimethylbenzenesulfonamide is Cc1ccc(S(=O)(=O)N(C)[C@@]2(O)CCc3ccccc32)cc1.
What is the InChIKey of N-[(1R)-1-hydroxy-2,3-dihydroinden-1-yl]-N,4-dimethylbenzenesulfonamide?
The InChIKey is DFMLVELOQNPSLS-QGZVFWFLSA-N. The full InChI is InChI=1S/C17H19NO3S/c1-13-7-9-15(10-8-13)22(20,21)18(2)17(19)12-11-14-5-3-4-6-16(14)17/h3-10,19H,11-12H2,1-2H3/t17-/m1/s1.
What are the key properties of N-[(1R)-1-hydroxy-2,3-dihydroinden-1-yl]-N,4-dimethylbenzenesulfonamide?
N-[(1R)-1-hydroxy-2,3-dihydroinden-1-yl]-N,4-dimethylbenzenesulfonamide has a molecular weight of 317.41 g/mol, XLogP of 2.41, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-1-hydroxy-2,3-dihydroinden-1-yl]-N,4-dimethylbenzenesulfonamide is sourced from PubChem (CID 70267678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).