C13H16O2 — CID 142155631
2-methoxy-2-(1,2,3,4-tetrahydronaphthalen-2-yl)oxirane (PubChem CID 142155631) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-methoxy-2-(1,2,3,4-tetrahydronaphthalen-2-yl)oxirane.
| Compound Name | 2-methoxy-2-(1,2,3,4-tetrahydronaphthalen-2-yl)oxirane |
|---|---|
| PubChem CID | 142155631 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 2-methoxy-2-(1,2,3,4-tetrahydronaphthalen-2-yl)oxirane |
| SMILES | COC1(C2CCc3ccccc3C2)CO1 |
| InChI | InChI=1S/C13H16O2/c1-14-13(9-15-13)12-7-6-10-4-2-3-5-11(10)8-12/h2-5,12H,6-9H2,1H3 |
| InChIKey | WLZOLSDLLRTENL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|