C28H36O6 — CID 139190613
(1S,5R,6S,13S)-6-hydroxy-8-methyl-4-methylidene-2-oxatricyclo[7.3.1.05,13]tridec-8-en-3-one (PubChem CID 139190613) has the molecular formula C28H36O6 and a molecular weight of 468.59 g/mol. Its IUPAC name is (1S,5R,6S,13S)-6-hydroxy-8-methyl-4-methylidene-2-oxatricyclo[7.3.1.05,13]tridec-8-en-3-one.
| Compound Name | (1S,5R,6S,13S)-6-hydroxy-8-methyl-4-methylidene-2-oxatricyclo[7.3.1.05,13]tridec-8-en-3-one |
|---|---|
| PubChem CID | 139190613 |
| Molecular Formula | C28H36O6 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | (1S,5R,6S,13S)-6-hydroxy-8-methyl-4-methylidene-2-oxatricyclo[7.3.1.05,13]tridec-8-en-3-one |
| SMILES | C=C1C(=O)O[C@H]2CCCC3=C(C)C[C@H](O)[C@@H]1[C@@H]32.C=C1C(=O)O[C@H]2CCCC3=C(C)C[C@H](O)[C@@H]1[C@@H]32 |
| InChI | InChI=1S/2C14H18O3/c2*1-7-6-10(15)12-8(2)14(16)17-11-5-3-4-9(7)13(11)12/h2*10-13,15H,2-6H2,1H3/t2*10-,11-,12+,13-/m00/s1 |
| InChIKey | IYJZLWXDANNRMB-LEARRHPOSA-N |
| XLogP | 3.93 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|