C13H16O4 — CID 134867217
9-hydroxy-1-methylidene-4,5,5a,6,7,8a,9,9a-octahydro-3aH-azuleno[6,7-b]furan-2,8-dione (PubChem CID 134867217) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 9-hydroxy-1-methylidene-4,5,5a,6,7,8a,9,9a-octahydro-3aH-azuleno[6,7-b]furan-2,8-dione.
| Compound Name | 9-hydroxy-1-methylidene-4,5,5a,6,7,8a,9,9a-octahydro-3aH-azuleno[6,7-b]furan-2,8-dione |
|---|---|
| PubChem CID | 134867217 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 9-hydroxy-1-methylidene-4,5,5a,6,7,8a,9,9a-octahydro-3aH-azuleno[6,7-b]furan-2,8-dione |
| SMILES | C=C1C(=O)OC2CCC3CCC(=O)C3C(O)C12 |
| InChI | InChI=1S/C13H16O4/c1-6-10-9(17-13(6)16)5-3-7-2-4-8(14)11(7)12(10)15/h7,9-12,15H,1-5H2 |
| InChIKey | PEPQNUKSHRRJDG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|