C14H16O4 — CID 163103080
(3aS,5R,5aR,8aR,9R,9aS)-9-hydroxy-5-methyl-1-methylidene-4,5,5a,8a,9,9a-hexahydro-3aH-azuleno[6,7-b]furan-2,8-dione (PubChem CID 163103080) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is (3aS,5R,5aR,8aR,9R,9aS)-9-hydroxy-5-methyl-1-methylidene-4,5,5a,8a,9,9a-hexahydro-3aH-azuleno[6,7-b]furan-2,8-dione.
| Compound Name | (3aS,5R,5aR,8aR,9R,9aS)-9-hydroxy-5-methyl-1-methylidene-4,5,5a,8a,9,9a-hexahydro-3aH-azuleno[6,7-b]furan-2,8-dione |
|---|---|
| PubChem CID | 163103080 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (3aS,5R,5aR,8aR,9R,9aS)-9-hydroxy-5-methyl-1-methylidene-4,5,5a,8a,9,9a-hexahydro-3aH-azuleno[6,7-b]furan-2,8-dione |
| SMILES | C=C1C(=O)O[C@H]2C[C@@H](C)[C@@H]3C=CC(=O)[C@H]3[C@H](O)[C@H]12 |
| InChI | InChI=1S/C14H16O4/c1-6-5-10-11(7(2)14(17)18-10)13(16)12-8(6)3-4-9(12)15/h3-4,6,8,10-13,16H,2,5H2,1H3/t6-,8+,10+,11-,12+,13-/m1/s1 |
| InChIKey | SGRYFGWTDKJCPA-HMWDMTHZSA-N |
| XLogP | 0.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|