C16H22O4 — CID 139454821
(3aS,4R,7Z,9R,10R,11aR)-9-ethyl-4-hydroxy-10-methyl-3-methylidene-4,5,9,10,11,11a-hexahydro-3aH-cyclodeca[b]furan-2,6-dione (PubChem CID 139454821) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (3aS,4R,7Z,9R,10R,11aR)-9-ethyl-4-hydroxy-10-methyl-3-methylidene-4,5,9,10,11,11a-hexahydro-3aH-cyclodeca[b]furan-2,6-dione.
| Compound Name | (3aS,4R,7Z,9R,10R,11aR)-9-ethyl-4-hydroxy-10-methyl-3-methylidene-4,5,9,10,11,11a-hexahydro-3aH-cyclodeca[b]furan-2,6-dione |
|---|---|
| PubChem CID | 139454821 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (3aS,4R,7Z,9R,10R,11aR)-9-ethyl-4-hydroxy-10-methyl-3-methylidene-4,5,9,10,11,11a-hexahydro-3aH-cyclodeca[b]furan-2,6-dione |
| SMILES | C=C1C(=O)O[C@@H]2C[C@@H](C)[C@@H](CC)/C=C\C(=O)C[C@@H](O)[C@H]12 |
| InChI | InChI=1S/C16H22O4/c1-4-11-5-6-12(17)8-13(18)15-10(3)16(19)20-14(15)7-9(11)2/h5-6,9,11,13-15,18H,3-4,7-8H2,1-2H3/b6-5-/t9-,11+,13-,14-,15+/m1/s1 |
| InChIKey | YNVIWZFKWMDYSX-CMOWTMOPSA-N |
| XLogP | 2.03 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|