C9H12O4 — CID 11480859
(3aS,4R,6R,6aR)-6-ethyl-4-hydroxy-3-methylidene-3a,4,6,6a-tetrahydrofuro[3,4-b]furan-2-one (PubChem CID 11480859) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is (3aS,4R,6R,6aR)-6-ethyl-4-hydroxy-3-methylidene-3a,4,6,6a-tetrahydrofuro[3,4-b]furan-2-one.
| Compound Name | (3aS,4R,6R,6aR)-6-ethyl-4-hydroxy-3-methylidene-3a,4,6,6a-tetrahydrofuro[3,4-b]furan-2-one |
|---|---|
| PubChem CID | 11480859 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (3aS,4R,6R,6aR)-6-ethyl-4-hydroxy-3-methylidene-3a,4,6,6a-tetrahydrofuro[3,4-b]furan-2-one |
| SMILES | C=C1C(=O)O[C@@H]2[C@H]1[C@H](O)O[C@@H]2CC |
| InChI | InChI=1S/C9H12O4/c1-3-5-7-6(9(11)12-5)4(2)8(10)13-7/h5-7,9,11H,2-3H2,1H3/t5-,6+,7+,9-/m1/s1 |
| InChIKey | BNDGDCBLQZUSCY-UTSKPXGSSA-N |
| XLogP | 0.21 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|