C15H20O7 — CID 10470746
(2R,4R,5R,9S,11S,12S,13R)-2,4,11,12-tetrahydroxy-2,11-dimethyl-6-methylidene-8,14-dioxatetracyclo[8.4.0.01,13.05,9]tetradecan-7-one (PubChem CID 10470746) has the molecular formula C15H20O7 and a molecular weight of 312.32 g/mol. Its IUPAC name is (2R,4R,5R,9S,11S,12S,13R)-2,4,11,12-tetrahydroxy-2,11-dimethyl-6-methylidene-8,14-dioxatetracyclo[8.4.0.01,13.05,9]tetradecan-7-one.
| Compound Name | (2R,4R,5R,9S,11S,12S,13R)-2,4,11,12-tetrahydroxy-2,11-dimethyl-6-methylidene-8,14-dioxatetracyclo[8.4.0.01,13.05,9]tetradecan-7-one |
|---|---|
| PubChem CID | 10470746 |
| Molecular Formula | C15H20O7 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (2R,4R,5R,9S,11S,12S,13R)-2,4,11,12-tetrahydroxy-2,11-dimethyl-6-methylidene-8,14-dioxatetracyclo[8.4.0.01,13.05,9]tetradecan-7-one |
| SMILES | C=C1C(=O)O[C@@H]2C3C(C)(O)[C@@H](O)[C@H]4OC34[C@](C)(O)C[C@@H](O)[C@@H]12 |
| InChI | InChI=1S/C15H20O7/c1-5-7-6(16)4-13(2,19)15-9(8(7)21-12(5)18)14(3,20)10(17)11(15)22-15/h6-11,16-17,19-20H,1,4H2,2-3H3/t6-,7-,8+,9?,10+,11-,13-,14?,15?/m1/s1 |
| InChIKey | VBYYZOIDIMKVGL-REZNINCYSA-N |
| XLogP | -1.52 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|