C15H19ClO5 — CID 14137584
11-chloro-2,12-dihydroxy-2,11-dimethyl-6-methylidene-8,14-dioxatetracyclo[8.4.0.01,13.05,9]tetradecan-7-one (PubChem CID 14137584) has the molecular formula C15H19ClO5 and a molecular weight of 314.77 g/mol. Its IUPAC name is 11-chloro-2,12-dihydroxy-2,11-dimethyl-6-methylidene-8,14-dioxatetracyclo[8.4.0.01,13.05,9]tetradecan-7-one.
| Compound Name | 11-chloro-2,12-dihydroxy-2,11-dimethyl-6-methylidene-8,14-dioxatetracyclo[8.4.0.01,13.05,9]tetradecan-7-one |
|---|---|
| PubChem CID | 14137584 |
| Molecular Formula | C15H19ClO5 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 11-chloro-2,12-dihydroxy-2,11-dimethyl-6-methylidene-8,14-dioxatetracyclo[8.4.0.01,13.05,9]tetradecan-7-one |
| SMILES | C=C1C(=O)OC2C1CCC(C)(O)C13OC1C(O)C(C)(Cl)C23 |
| InChI | InChI=1S/C15H19ClO5/c1-6-7-4-5-13(2,19)15-9(8(7)20-12(6)18)14(3,16)10(17)11(15)21-15/h7-11,17,19H,1,4-5H2,2-3H3 |
| InChIKey | OBUQSMIGOUJNTL-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|