C15H19ClO3 — CID 14466138
(3aS,6S,6aS,9aR,9bS)-6a-chloro-6-hydroxy-6,9-dimethyl-3-methylidene-3a,4,5,7,9a,9b-hexahydroazuleno[4,5-b]furan-2-one (PubChem CID 14466138) has the molecular formula C15H19ClO3 and a molecular weight of 282.77 g/mol. Its IUPAC name is (3aS,6S,6aS,9aR,9bS)-6a-chloro-6-hydroxy-6,9-dimethyl-3-methylidene-3a,4,5,7,9a,9b-hexahydroazuleno[4,5-b]furan-2-one.
| Compound Name | (3aS,6S,6aS,9aR,9bS)-6a-chloro-6-hydroxy-6,9-dimethyl-3-methylidene-3a,4,5,7,9a,9b-hexahydroazuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 14466138 |
| Molecular Formula | C15H19ClO3 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | (3aS,6S,6aS,9aR,9bS)-6a-chloro-6-hydroxy-6,9-dimethyl-3-methylidene-3a,4,5,7,9a,9b-hexahydroazuleno[4,5-b]furan-2-one |
| SMILES | C=C1C(=O)O[C@@H]2[C@H]3C(C)=CC[C@@]3(Cl)[C@@](C)(O)CC[C@@H]12 |
| InChI | InChI=1S/C15H19ClO3/c1-8-4-7-15(16)11(8)12-10(5-6-14(15,3)18)9(2)13(17)19-12/h4,10-12,18H,2,5-7H2,1,3H3/t10-,11+,12-,14-,15-/m0/s1 |
| InChIKey | RQLRQXZXNLQAKX-XXUMUBMXSA-N |
| XLogP | 2.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|