C22H24O4 — CID 164623299
[(3aS,5aR,6R,9aS,9bS)-5a,9-dimethyl-3-methylidene-2-oxo-4,5,6,7,9a,9b-hexahydro-3aH-benzo[g][1]benzofuran-6-yl] benzoate (PubChem CID 164623299) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is [(3aS,5aR,6R,9aS,9bS)-5a,9-dimethyl-3-methylidene-2-oxo-4,5,6,7,9a,9b-hexahydro-3aH-benzo[g][1]benzofuran-6-yl] benzoate.
| Compound Name | [(3aS,5aR,6R,9aS,9bS)-5a,9-dimethyl-3-methylidene-2-oxo-4,5,6,7,9a,9b-hexahydro-3aH-benzo[g][1]benzofuran-6-yl] benzoate |
|---|---|
| PubChem CID | 164623299 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | [(3aS,5aR,6R,9aS,9bS)-5a,9-dimethyl-3-methylidene-2-oxo-4,5,6,7,9a,9b-hexahydro-3aH-benzo[g][1]benzofuran-6-yl] benzoate |
| SMILES | C=C1C(=O)O[C@@H]2[C@H]3C(C)=CC[C@@H](OC(=O)c4ccccc4)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C22H24O4/c1-13-9-10-17(25-21(24)15-7-5-4-6-8-15)22(3)12-11-16-14(2)20(23)26-19(16)18(13)22/h4-9,16-19H,2,10-12H2,1,3H3/t16-,17+,18+,19-,22-/m0/s1 |
| InChIKey | FGAHGKNJWZZDTB-TZDBLYRBSA-N |
| XLogP | 4.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|