C20H24O4 — CID 101306811
[(3aS,5aR,6S,9aS,9bS)-5a-methyl-3,9-dimethylidene-2-oxo-3a,4,5,6,9a,9b-hexahydrobenzo[g][1]benzofuran-6-yl] (Z)-2-methylbut-2-enoate (PubChem CID 101306811) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is [(3aS,5aR,6S,9aS,9bS)-5a-methyl-3,9-dimethylidene-2-oxo-3a,4,5,6,9a,9b-hexahydrobenzo[g][1]benzofuran-6-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(3aS,5aR,6S,9aS,9bS)-5a-methyl-3,9-dimethylidene-2-oxo-3a,4,5,6,9a,9b-hexahydrobenzo[g][1]benzofuran-6-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 101306811 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | [(3aS,5aR,6S,9aS,9bS)-5a-methyl-3,9-dimethylidene-2-oxo-3a,4,5,6,9a,9b-hexahydrobenzo[g][1]benzofuran-6-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C=C1C=C[C@H](OC(=O)/C(C)=C\C)[C@]2(C)CC[C@H]3C(=C)C(=O)O[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C20H24O4/c1-6-11(2)18(21)23-15-8-7-12(3)16-17-14(9-10-20(15,16)5)13(4)19(22)24-17/h6-8,14-17H,3-4,9-10H2,1-2,5H3/b11-6-/t14-,15-,16+,17-,20-/m0/s1 |
| InChIKey | JBUBIHUTEIWJSH-IDDFNINDSA-N |
| XLogP | 3.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|