C20H26O7 — CID 162842218
(6,6a,9-trihydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-5-yl) 2-methylbut-2-enoate (PubChem CID 162842218) has the molecular formula C20H26O7 and a molecular weight of 378.42 g/mol. Its IUPAC name is (6,6a,9-trihydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-5-yl) 2-methylbut-2-enoate.
| Compound Name | (6,6a,9-trihydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-5-yl) 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162842218 |
| Molecular Formula | C20H26O7 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (6,6a,9-trihydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-5-yl) 2-methylbut-2-enoate |
| SMILES | C=C1C(=O)OC2C1CC(OC(=O)C(C)=CC)C(C)(O)C1(O)C=CC(C)(O)C21 |
| InChI | InChI=1S/C20H26O7/c1-6-10(2)16(21)26-13-9-12-11(3)17(22)27-14(12)15-18(4,23)7-8-20(15,25)19(13,5)24/h6-8,12-15,23-25H,3,9H2,1-2,4-5H3 |
| InChIKey | SQRSEJMUWJOLCL-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|