C24H32O8 — CID 163026959
[4,9-dihydroxy-8a-methyl-8-(2-methylbut-2-enoyloxy)-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,5-b]furan-6-yl] 2-methylbut-2-enoate (PubChem CID 163026959) has the molecular formula C24H32O8 and a molecular weight of 448.51 g/mol. Its IUPAC name is [4,9-dihydroxy-8a-methyl-8-(2-methylbut-2-enoyloxy)-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,5-b]furan-6-yl] 2-methylbut-2-enoate.
| Compound Name | [4,9-dihydroxy-8a-methyl-8-(2-methylbut-2-enoyloxy)-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,5-b]furan-6-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163026959 |
| Molecular Formula | C24H32O8 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | [4,9-dihydroxy-8a-methyl-8-(2-methylbut-2-enoyloxy)-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,5-b]furan-6-yl] 2-methylbut-2-enoate |
| SMILES | C=C1C(=O)OC2C(O)CC3C(OC(=O)C(C)=CC)CC(OC(=O)C(C)=CC)C3(C)C(O)C12 |
| InChI | InChI=1S/C24H32O8/c1-7-11(3)21(27)30-16-10-17(31-22(28)12(4)8-2)24(6)14(16)9-15(25)19-18(20(24)26)13(5)23(29)32-19/h7-8,14-20,25-26H,5,9-10H2,1-4,6H3 |
| InChIKey | XSPHEMSVWATZSO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|