C20H28O6 — CID 162860501
(8,9-dihydroxy-5,8a-dimethyl-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,5-b]furan-6-yl) 2-methylbut-2-enoate (PubChem CID 162860501) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is (8,9-dihydroxy-5,8a-dimethyl-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,5-b]furan-6-yl) 2-methylbut-2-enoate.
| Compound Name | (8,9-dihydroxy-5,8a-dimethyl-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,5-b]furan-6-yl) 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162860501 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (8,9-dihydroxy-5,8a-dimethyl-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,5-b]furan-6-yl) 2-methylbut-2-enoate |
| SMILES | C=C1C(=O)OC2CC(C)C3C(OC(=O)C(C)=CC)CC(O)C3(C)C(O)C12 |
| InChI | InChI=1S/C20H28O6/c1-6-9(2)18(23)26-13-8-14(21)20(5)16(13)10(3)7-12-15(17(20)22)11(4)19(24)25-12/h6,10,12-17,21-22H,4,7-8H2,1-3,5H3 |
| InChIKey | PJRLXBDFTLKEMI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|