C23H34O7 — CID 162968306
(6-hydroxy-6,10-dimethyl-3-methylidene-2,7-dioxo-9-propan-2-yloxy-3a,4,5,8,9,10,11,11a-octahydrocyclodeca[b]furan-4-yl) 2-methylbut-2-enoate (PubChem CID 162968306) has the molecular formula C23H34O7 and a molecular weight of 422.52 g/mol. Its IUPAC name is (6-hydroxy-6,10-dimethyl-3-methylidene-2,7-dioxo-9-propan-2-yloxy-3a,4,5,8,9,10,11,11a-octahydrocyclodeca[b]furan-4-yl) 2-methylbut-2-enoate.
| Compound Name | (6-hydroxy-6,10-dimethyl-3-methylidene-2,7-dioxo-9-propan-2-yloxy-3a,4,5,8,9,10,11,11a-octahydrocyclodeca[b]furan-4-yl) 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162968306 |
| Molecular Formula | C23H34O7 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | (6-hydroxy-6,10-dimethyl-3-methylidene-2,7-dioxo-9-propan-2-yloxy-3a,4,5,8,9,10,11,11a-octahydrocyclodeca[b]furan-4-yl) 2-methylbut-2-enoate |
| SMILES | C=C1C(=O)OC2CC(C)C(OC(C)C)CC(=O)C(C)(O)CC(OC(=O)C(C)=CC)C12 |
| InChI | InChI=1S/C23H34O7/c1-8-13(4)21(25)30-18-11-23(7,27)19(24)10-16(28-12(2)3)14(5)9-17-20(18)15(6)22(26)29-17/h8,12,14,16-18,20,27H,6,9-11H2,1-5,7H3 |
| InChIKey | NFLZVTKKPVSKES-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|