C20H26O6 — CID 162973320
[(1R,3R,7R,8S,10R,11R)-11-hydroxy-10,13-dimethyl-6-methylidene-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradec-12-en-8-yl] (Z)-2-methylbut-2-enoate (PubChem CID 162973320) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is [(1R,3R,7R,8S,10R,11R)-11-hydroxy-10,13-dimethyl-6-methylidene-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradec-12-en-8-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1R,3R,7R,8S,10R,11R)-11-hydroxy-10,13-dimethyl-6-methylidene-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradec-12-en-8-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162973320 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | [(1R,3R,7R,8S,10R,11R)-11-hydroxy-10,13-dimethyl-6-methylidene-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradec-12-en-8-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C=C1C(=O)O[C@@H]2C[C@H]3O[C@@](O)(C=C3C)[C@H](C)C[C@H](OC(=O)/C(C)=C\C)[C@@H]12 |
| InChI | InChI=1S/C20H26O6/c1-6-10(2)18(21)24-15-7-12(4)20(23)9-11(3)14(26-20)8-16-17(15)13(5)19(22)25-16/h6,9,12,14-17,23H,5,7-8H2,1-4H3/b10-6-/t12-,14-,15+,16-,17-,20+/m1/s1 |
| InChIKey | JHAIOJGPPHPVOU-DSSROWOTSA-N |
| XLogP | 2.43 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|