C19H26O7 — CID 163045318
(4,8,9-trihydroxy-8a-methyl-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,5-b]furan-6-yl) 2-methylbut-2-enoate (PubChem CID 163045318) has the molecular formula C19H26O7 and a molecular weight of 366.41 g/mol. Its IUPAC name is (4,8,9-trihydroxy-8a-methyl-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,5-b]furan-6-yl) 2-methylbut-2-enoate.
| Compound Name | (4,8,9-trihydroxy-8a-methyl-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,5-b]furan-6-yl) 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163045318 |
| Molecular Formula | C19H26O7 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (4,8,9-trihydroxy-8a-methyl-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,5-b]furan-6-yl) 2-methylbut-2-enoate |
| SMILES | C=C1C(=O)OC2C(O)CC3C(OC(=O)C(C)=CC)CC(O)C3(C)C(O)C12 |
| InChI | InChI=1S/C19H26O7/c1-5-8(2)17(23)25-12-7-13(21)19(4)10(12)6-11(20)15-14(16(19)22)9(3)18(24)26-15/h5,10-16,20-22H,3,6-7H2,1-2,4H3 |
| InChIKey | NNQHFYLCSCNRKO-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|