C17H21ClO7 — CID 102180779
[(1R,2S,3S,5S,11S,12S,13R)-12-chloro-2,11-dihydroxy-2,11-dimethyl-6-methylidene-7-oxo-8,14-dioxatetracyclo[8.4.0.01,13.05,9]tetradecan-3-yl] acetate (PubChem CID 102180779) has the molecular formula C17H21ClO7 and a molecular weight of 372.80 g/mol. Its IUPAC name is [(1R,2S,3S,5S,11S,12S,13R)-12-chloro-2,11-dihydroxy-2,11-dimethyl-6-methylidene-7-oxo-8,14-dioxatetracyclo[8.4.0.01,13.05,9]tetradecan-3-yl] acetate.
| Compound Name | [(1R,2S,3S,5S,11S,12S,13R)-12-chloro-2,11-dihydroxy-2,11-dimethyl-6-methylidene-7-oxo-8,14-dioxatetracyclo[8.4.0.01,13.05,9]tetradecan-3-yl] acetate |
|---|---|
| PubChem CID | 102180779 |
| Molecular Formula | C17H21ClO7 |
| Molecular Weight | 372.80 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | [(1R,2S,3S,5S,11S,12S,13R)-12-chloro-2,11-dihydroxy-2,11-dimethyl-6-methylidene-7-oxo-8,14-dioxatetracyclo[8.4.0.01,13.05,9]tetradecan-3-yl] acetate |
| SMILES | C=C1C(=O)OC2C3C(C)(O)[C@@H](Cl)[C@@H]4O[C@]34[C@@](C)(O)[C@@H](OC(C)=O)C[C@@H]12 |
| InChI | InChI=1S/C17H21ClO7/c1-6-8-5-9(23-7(2)19)16(4,22)17-11(10(8)24-14(6)20)15(3,21)12(18)13(17)25-17/h8-13,21-22H,1,5H2,2-4H3/t8-,9-,10?,11?,12-,13-,15?,16-,17+/m0/s1 |
| InChIKey | WZHNDBOONHRJEN-ZPPAXIOZSA-N |
| XLogP | 0.30 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.80 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|