C17H20O7 — CID 14779612
(6,9a-dihydroxy-6,9-dimethyl-3-methylidene-2,7-dioxo-4,5,6a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-5-yl) acetate (PubChem CID 14779612) has the molecular formula C17H20O7 and a molecular weight of 336.34 g/mol. Its IUPAC name is (6,9a-dihydroxy-6,9-dimethyl-3-methylidene-2,7-dioxo-4,5,6a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-5-yl) acetate.
| Compound Name | (6,9a-dihydroxy-6,9-dimethyl-3-methylidene-2,7-dioxo-4,5,6a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-5-yl) acetate |
|---|---|
| PubChem CID | 14779612 |
| Molecular Formula | C17H20O7 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | (6,9a-dihydroxy-6,9-dimethyl-3-methylidene-2,7-dioxo-4,5,6a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-5-yl) acetate |
| SMILES | C=C1C(=O)OC2C1CC(OC(C)=O)C(C)(O)C1C(=O)C=C(C)C21O |
| InChI | InChI=1S/C17H20O7/c1-7-5-11(19)13-16(4,21)12(23-9(3)18)6-10-8(2)15(20)24-14(10)17(7,13)22/h5,10,12-14,21-22H,2,6H2,1,3-4H3 |
| InChIKey | HGZUDBQQCCXOAZ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|