C24H34O8 — CID 45271265
[(3aR,5S,6S,9E,13E,15R,15aR)-5-acetyloxy-6,15-dihydroxy-10,14-dimethyl-3-methylidene-2-oxo-4,5,7,8,11,12,15,15a-octahydro-3aH-cyclotetradeca[b]furan-6-yl]methyl acetate (PubChem CID 45271265) has the molecular formula C24H34O8 and a molecular weight of 450.53 g/mol. Its IUPAC name is [(3aR,5S,6S,9E,13E,15R,15aR)-5-acetyloxy-6,15-dihydroxy-10,14-dimethyl-3-methylidene-2-oxo-4,5,7,8,11,12,15,15a-octahydro-3aH-cyclotetradeca[b]furan-6-yl]methyl acetate.
| Compound Name | [(3aR,5S,6S,9E,13E,15R,15aR)-5-acetyloxy-6,15-dihydroxy-10,14-dimethyl-3-methylidene-2-oxo-4,5,7,8,11,12,15,15a-octahydro-3aH-cyclotetradeca[b]furan-6-yl]methyl acetate |
|---|---|
| PubChem CID | 45271265 |
| Molecular Formula | C24H34O8 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | [(3aR,5S,6S,9E,13E,15R,15aR)-5-acetyloxy-6,15-dihydroxy-10,14-dimethyl-3-methylidene-2-oxo-4,5,7,8,11,12,15,15a-octahydro-3aH-cyclotetradeca[b]furan-6-yl]methyl acetate |
| SMILES | C=C1C(=O)O[C@@H]2[C@@H]1C[C@H](OC(C)=O)[C@@](O)(COC(C)=O)CC/C=C(\C)CC/C=C(\C)[C@H]2O |
| InChI | InChI=1S/C24H34O8/c1-14-8-6-10-15(2)21(27)22-19(16(3)23(28)32-22)12-20(31-18(5)26)24(29,11-7-9-14)13-30-17(4)25/h9-10,19-22,27,29H,3,6-8,11-13H2,1-2,4-5H3/b14-9+,15-10+/t19-,20+,21-,22-,24+/m1/s1 |
| InChIKey | KOXLNTVHCAHJPE-AVGSJBJPSA-N |
| XLogP | 2.53 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|