C22H32O5 — CID 10571579
[(3aS,5S,9E,14S,15R,15aR)-5-hydroxy-10,14-dimethyl-3,6-dimethylidene-2-oxo-4,5,7,8,11,12,13,14,15,15a-decahydro-3aH-cyclotetradeca[b]furan-15-yl] acetate (PubChem CID 10571579) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is [(3aS,5S,9E,14S,15R,15aR)-5-hydroxy-10,14-dimethyl-3,6-dimethylidene-2-oxo-4,5,7,8,11,12,13,14,15,15a-decahydro-3aH-cyclotetradeca[b]furan-15-yl] acetate.
| Compound Name | [(3aS,5S,9E,14S,15R,15aR)-5-hydroxy-10,14-dimethyl-3,6-dimethylidene-2-oxo-4,5,7,8,11,12,13,14,15,15a-decahydro-3aH-cyclotetradeca[b]furan-15-yl] acetate |
|---|---|
| PubChem CID | 10571579 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | [(3aS,5S,9E,14S,15R,15aR)-5-hydroxy-10,14-dimethyl-3,6-dimethylidene-2-oxo-4,5,7,8,11,12,13,14,15,15a-decahydro-3aH-cyclotetradeca[b]furan-15-yl] acetate |
| SMILES | C=C1CC/C=C(\C)CCC[C@H](C)[C@@H](OC(C)=O)[C@@H]2OC(=O)C(=C)[C@@H]2C[C@@H]1O |
| InChI | InChI=1S/C22H32O5/c1-13-8-6-10-14(2)19(24)12-18-16(4)22(25)27-21(18)20(26-17(5)23)15(3)11-7-9-13/h8,15,18-21,24H,2,4,6-7,9-12H2,1,3,5H3/b13-8+/t15-,18-,19-,20+,21+/m0/s1 |
| InChIKey | IIHISVFXWMWKEB-KRCDBNDCSA-N |
| XLogP | 3.87 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|