C17H24O6 — CID 162879697
(6,9-dihydroxy-5a,9-dimethyl-3-methylidene-2-oxo-3a,4,5,6,7,8,9a,9b-octahydrobenzo[g][1]benzofuran-8-yl) acetate (PubChem CID 162879697) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is (6,9-dihydroxy-5a,9-dimethyl-3-methylidene-2-oxo-3a,4,5,6,7,8,9a,9b-octahydrobenzo[g][1]benzofuran-8-yl) acetate.
| Compound Name | (6,9-dihydroxy-5a,9-dimethyl-3-methylidene-2-oxo-3a,4,5,6,7,8,9a,9b-octahydrobenzo[g][1]benzofuran-8-yl) acetate |
|---|---|
| PubChem CID | 162879697 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (6,9-dihydroxy-5a,9-dimethyl-3-methylidene-2-oxo-3a,4,5,6,7,8,9a,9b-octahydrobenzo[g][1]benzofuran-8-yl) acetate |
| SMILES | C=C1C(=O)OC2C1CCC1(C)C(O)CC(OC(C)=O)C(C)(O)C21 |
| InChI | InChI=1S/C17H24O6/c1-8-10-5-6-16(3)11(19)7-12(22-9(2)18)17(4,21)14(16)13(10)23-15(8)20/h10-14,19,21H,1,5-7H2,2-4H3 |
| InChIKey | WPYXQPOWXYSXPW-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|