C17H21ClO5 — CID 162816966
[(3aS,6S,6aR,8S,9aR,9bS)-6-(chloromethyl)-6-hydroxy-3,9-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-8-yl] acetate (PubChem CID 162816966) has the molecular formula C17H21ClO5 and a molecular weight of 340.80 g/mol. Its IUPAC name is [(3aS,6S,6aR,8S,9aR,9bS)-6-(chloromethyl)-6-hydroxy-3,9-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-8-yl] acetate.
| Compound Name | [(3aS,6S,6aR,8S,9aR,9bS)-6-(chloromethyl)-6-hydroxy-3,9-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-8-yl] acetate |
|---|---|
| PubChem CID | 162816966 |
| Molecular Formula | C17H21ClO5 |
| Molecular Weight | 340.80 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | [(3aS,6S,6aR,8S,9aR,9bS)-6-(chloromethyl)-6-hydroxy-3,9-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-8-yl] acetate |
| SMILES | C=C1[C@@H]2[C@H]3OC(=O)C(=C)[C@@H]3CC[C@@](O)(CCl)[C@@H]2C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H21ClO5/c1-8-11-4-5-17(21,7-18)12-6-13(22-10(3)19)9(2)14(12)15(11)23-16(8)20/h11-15,21H,1-2,4-7H2,3H3/t11-,12+,13-,14-,15-,17+/m0/s1 |
| InChIKey | AAGASLNRMNLPPK-XCNHXOCXSA-N |
| XLogP | 1.97 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.80 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|