C20H26O7 — CID 14682839
(2-hydroxy-2,11-dimethyl-6-methylidene-7-oxo-8,12,13-trioxatetracyclo[9.2.2.01,10.05,9]pentadec-14-en-3-yl) 3-methylbutanoate (PubChem CID 14682839) has the molecular formula C20H26O7 and a molecular weight of 378.42 g/mol. Its IUPAC name is (2-hydroxy-2,11-dimethyl-6-methylidene-7-oxo-8,12,13-trioxatetracyclo[9.2.2.01,10.05,9]pentadec-14-en-3-yl) 3-methylbutanoate.
| Compound Name | (2-hydroxy-2,11-dimethyl-6-methylidene-7-oxo-8,12,13-trioxatetracyclo[9.2.2.01,10.05,9]pentadec-14-en-3-yl) 3-methylbutanoate |
|---|---|
| PubChem CID | 14682839 |
| Molecular Formula | C20H26O7 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (2-hydroxy-2,11-dimethyl-6-methylidene-7-oxo-8,12,13-trioxatetracyclo[9.2.2.01,10.05,9]pentadec-14-en-3-yl) 3-methylbutanoate |
| SMILES | C=C1C(=O)OC2C1CC(OC(=O)CC(C)C)C(C)(O)C13C=CC(C)(OO1)C23 |
| InChI | InChI=1S/C20H26O7/c1-10(2)8-14(21)24-13-9-12-11(3)17(22)25-15(12)16-18(4)6-7-20(16,27-26-18)19(13,5)23/h6-7,10,12-13,15-16,23H,3,8-9H2,1-2,4-5H3 |
| InChIKey | VZDQQSIOBHVJOY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|