C19H26O6 — CID 162916447
2-hydroxy-2,11-dimethyl-6-methylidene-3-(2-methylpropoxy)-8,12,13-trioxatetracyclo[9.2.2.01,10.05,9]pentadec-14-en-7-one (PubChem CID 162916447) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is 2-hydroxy-2,11-dimethyl-6-methylidene-3-(2-methylpropoxy)-8,12,13-trioxatetracyclo[9.2.2.01,10.05,9]pentadec-14-en-7-one.
| Compound Name | 2-hydroxy-2,11-dimethyl-6-methylidene-3-(2-methylpropoxy)-8,12,13-trioxatetracyclo[9.2.2.01,10.05,9]pentadec-14-en-7-one |
|---|---|
| PubChem CID | 162916447 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 2-hydroxy-2,11-dimethyl-6-methylidene-3-(2-methylpropoxy)-8,12,13-trioxatetracyclo[9.2.2.01,10.05,9]pentadec-14-en-7-one |
| SMILES | C=C1C(=O)OC2C1CC(OCC(C)C)C(C)(O)C13C=CC(C)(OO1)C23 |
| InChI | InChI=1S/C19H26O6/c1-10(2)9-22-13-8-12-11(3)16(20)23-14(12)15-17(4)6-7-19(15,25-24-17)18(13,5)21/h6-7,10,12-15,21H,3,8-9H2,1-2,4-5H3 |
| InChIKey | OGNZUWQGRXJUHI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|