C20H30O6 — CID 162966902
1-hydroxy-12-methoxy-2,11-dimethyl-7-methylidene-9-(2-methylpropoxy)-5,14-dioxatricyclo[9.2.1.04,8]tetradec-2-en-6-one (PubChem CID 162966902) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is 1-hydroxy-12-methoxy-2,11-dimethyl-7-methylidene-9-(2-methylpropoxy)-5,14-dioxatricyclo[9.2.1.04,8]tetradec-2-en-6-one.
| Compound Name | 1-hydroxy-12-methoxy-2,11-dimethyl-7-methylidene-9-(2-methylpropoxy)-5,14-dioxatricyclo[9.2.1.04,8]tetradec-2-en-6-one |
|---|---|
| PubChem CID | 162966902 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 1-hydroxy-12-methoxy-2,11-dimethyl-7-methylidene-9-(2-methylpropoxy)-5,14-dioxatricyclo[9.2.1.04,8]tetradec-2-en-6-one |
| SMILES | C=C1C(=O)OC2C=C(C)C3(O)CC(OC)C(C)(CC(OCC(C)C)C12)O3 |
| InChI | InChI=1S/C20H30O6/c1-11(2)10-24-15-8-19(5)16(23-6)9-20(22,26-19)12(3)7-14-17(15)13(4)18(21)25-14/h7,11,14-17,22H,4,8-10H2,1-3,5-6H3 |
| InChIKey | QGVLFHYKTCRSKD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|