C23H28Cl6O7 — CID 46866620
[(1R,2E,4R,8R,11R)-2,11-dimethyl-7-methylidene-6-oxo-1,12-bis(2,2,2-trichloroethoxy)-5,14-dioxatricyclo[9.2.1.04,8]tetradec-2-en-9-yl] 2-methylpropanoate (PubChem CID 46866620) has the molecular formula C23H28Cl6O7 and a molecular weight of 629.19 g/mol. Its IUPAC name is [(1R,2E,4R,8R,11R)-2,11-dimethyl-7-methylidene-6-oxo-1,12-bis(2,2,2-trichloroethoxy)-5,14-dioxatricyclo[9.2.1.04,8]tetradec-2-en-9-yl] 2-methylpropanoate.
| Compound Name | [(1R,2E,4R,8R,11R)-2,11-dimethyl-7-methylidene-6-oxo-1,12-bis(2,2,2-trichloroethoxy)-5,14-dioxatricyclo[9.2.1.04,8]tetradec-2-en-9-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 46866620 |
| Molecular Formula | C23H28Cl6O7 |
| Molecular Weight | 629.19 g/mol |
| Exact Mass | 626.00 |
| IUPAC Name | [(1R,2E,4R,8R,11R)-2,11-dimethyl-7-methylidene-6-oxo-1,12-bis(2,2,2-trichloroethoxy)-5,14-dioxatricyclo[9.2.1.04,8]tetradec-2-en-9-yl] 2-methylpropanoate |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(\C)[C@@]3(OCC(Cl)(Cl)Cl)CC(OCC(Cl)(Cl)Cl)[C@@](C)(CC(OC(=O)C(C)C)[C@@H]12)O3 |
| InChI | InChI=1S/C23H28Cl6O7/c1-11(2)18(30)35-15-7-20(5)16(32-9-22(24,25)26)8-21(36-20,33-10-23(27,28)29)12(3)6-14-17(15)13(4)19(31)34-14/h6,11,14-17H,4,7-10H2,1-3,5H3/b12-6+/t14-,15?,16?,17+,20-,21-/m1/s1 |
| InChIKey | IJCHQZQWDMBLOO-IQSDNLDQSA-N |
| XLogP | 6.02 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.19 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|