C19H22O7 — CID 163103476
[(1S,2E,4S,8R,9S,11S)-1-hydroxy-2,11-dimethyl-7-methylidene-6,12-dioxo-5,14-dioxatricyclo[9.2.1.04,8]tetradec-2-en-9-yl] 2-methylprop-2-enoate (PubChem CID 163103476) has the molecular formula C19H22O7 and a molecular weight of 362.38 g/mol. Its IUPAC name is [(1S,2E,4S,8R,9S,11S)-1-hydroxy-2,11-dimethyl-7-methylidene-6,12-dioxo-5,14-dioxatricyclo[9.2.1.04,8]tetradec-2-en-9-yl] 2-methylprop-2-enoate.
| Compound Name | [(1S,2E,4S,8R,9S,11S)-1-hydroxy-2,11-dimethyl-7-methylidene-6,12-dioxo-5,14-dioxatricyclo[9.2.1.04,8]tetradec-2-en-9-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163103476 |
| Molecular Formula | C19H22O7 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | [(1S,2E,4S,8R,9S,11S)-1-hydroxy-2,11-dimethyl-7-methylidene-6,12-dioxo-5,14-dioxatricyclo[9.2.1.04,8]tetradec-2-en-9-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[C@H]1C[C@]2(C)O[C@@](O)(CC2=O)/C(C)=C/[C@@H]2OC(=O)C(=C)[C@@H]21 |
| InChI | InChI=1S/C19H22O7/c1-9(2)16(21)25-13-7-18(5)14(20)8-19(23,26-18)10(3)6-12-15(13)11(4)17(22)24-12/h6,12-13,15,23H,1,4,7-8H2,2-3,5H3/b10-6+/t12-,13-,15-,18-,19-/m0/s1 |
| InChIKey | BCMUYGUCOSUWJQ-ONAOVKKOSA-N |
| XLogP | 1.36 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|