C19H24O6 — CID 163086151
(6-hydroxy-6,10-dimethyl-3-methylidene-2,7-dioxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl) 2-methylprop-2-enoate (PubChem CID 163086151) has the molecular formula C19H24O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is (6-hydroxy-6,10-dimethyl-3-methylidene-2,7-dioxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl) 2-methylprop-2-enoate.
| Compound Name | (6-hydroxy-6,10-dimethyl-3-methylidene-2,7-dioxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163086151 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (6-hydroxy-6,10-dimethyl-3-methylidene-2,7-dioxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC(C)(O)C(=O)CCC(C)=CC2OC(=O)C(=C)C21 |
| InChI | InChI=1S/C19H24O6/c1-10(2)17(21)25-14-9-19(5,23)15(20)7-6-11(3)8-13-16(14)12(4)18(22)24-13/h8,13-14,16,23H,1,4,6-7,9H2,2-3,5H3 |
| InChIKey | AYLHAROHTWZRTO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|