C21H28O8 — CID 162789880
[(3aS,4S,5S,6S,9Z,10aS)-5-acetyloxy-6-[(1S)-1-hydroxyethyl]-6,9-dimethyl-3-methylidene-2-oxo-4,5,8,10a-tetrahydro-3aH-furo[2,3-e]oxonin-4-yl] 2-methylprop-2-enoate (PubChem CID 162789880) has the molecular formula C21H28O8 and a molecular weight of 408.45 g/mol. Its IUPAC name is [(3aS,4S,5S,6S,9Z,10aS)-5-acetyloxy-6-[(1S)-1-hydroxyethyl]-6,9-dimethyl-3-methylidene-2-oxo-4,5,8,10a-tetrahydro-3aH-furo[2,3-e]oxonin-4-yl] 2-methylprop-2-enoate.
| Compound Name | [(3aS,4S,5S,6S,9Z,10aS)-5-acetyloxy-6-[(1S)-1-hydroxyethyl]-6,9-dimethyl-3-methylidene-2-oxo-4,5,8,10a-tetrahydro-3aH-furo[2,3-e]oxonin-4-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 162789880 |
| Molecular Formula | C21H28O8 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [(3aS,4S,5S,6S,9Z,10aS)-5-acetyloxy-6-[(1S)-1-hydroxyethyl]-6,9-dimethyl-3-methylidene-2-oxo-4,5,8,10a-tetrahydro-3aH-furo[2,3-e]oxonin-4-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[C@H]1[C@H]2C(=C)C(=O)O[C@H]2/C=C(/C)CO[C@@](C)([C@H](C)O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H28O8/c1-10(2)19(24)29-17-16-12(4)20(25)28-15(16)8-11(3)9-26-21(7,13(5)22)18(17)27-14(6)23/h8,13,15-18,22H,1,4,9H2,2-3,5-7H3/b11-8-/t13-,15-,16-,17-,18-,21-/m0/s1 |
| InChIKey | NCAKRLCHHKDUKE-PAMSWNPGSA-N |
| XLogP | 1.62 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|