C15H20O6 — CID 46866008
(1R,2E,4R,8R,9R,11R,12S)-1,9,12-trihydroxy-2,11-dimethyl-7-methylidene-5,14-dioxatricyclo[9.2.1.04,8]tetradec-2-en-6-one (PubChem CID 46866008) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is (1R,2E,4R,8R,9R,11R,12S)-1,9,12-trihydroxy-2,11-dimethyl-7-methylidene-5,14-dioxatricyclo[9.2.1.04,8]tetradec-2-en-6-one.
| Compound Name | (1R,2E,4R,8R,9R,11R,12S)-1,9,12-trihydroxy-2,11-dimethyl-7-methylidene-5,14-dioxatricyclo[9.2.1.04,8]tetradec-2-en-6-one |
|---|---|
| PubChem CID | 46866008 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (1R,2E,4R,8R,9R,11R,12S)-1,9,12-trihydroxy-2,11-dimethyl-7-methylidene-5,14-dioxatricyclo[9.2.1.04,8]tetradec-2-en-6-one |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(\C)[C@@]3(O)C[C@H](O)[C@@](C)(C[C@@H](O)[C@@H]12)O3 |
| InChI | InChI=1S/C15H20O6/c1-7-4-10-12(8(2)13(18)20-10)9(16)5-14(3)11(17)6-15(7,19)21-14/h4,9-12,16-17,19H,2,5-6H2,1,3H3/b7-4+/t9-,10-,11+,12-,14-,15-/m1/s1 |
| InChIKey | ONMJOKZMJBYJFM-MXPGIJIJSA-N |
| XLogP | 0.02 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|