C15H18O5 — CID 100955713
(1R,2S,6R,7S,10S,12R,14S)-7,10-dihydroxy-14-methyl-5,9-dimethylidene-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradecan-4-one (PubChem CID 100955713) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is (1R,2S,6R,7S,10S,12R,14S)-7,10-dihydroxy-14-methyl-5,9-dimethylidene-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradecan-4-one.
| Compound Name | (1R,2S,6R,7S,10S,12R,14S)-7,10-dihydroxy-14-methyl-5,9-dimethylidene-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradecan-4-one |
|---|---|
| PubChem CID | 100955713 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (1R,2S,6R,7S,10S,12R,14S)-7,10-dihydroxy-14-methyl-5,9-dimethylidene-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradecan-4-one |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1[C@@H](O)CC(=C)[C@]1(O)C[C@H]3O[C@@]3(C)[C@H]21 |
| InChI | InChI=1S/C15H18O5/c1-6-4-8(16)10-7(2)13(17)19-11(10)12-14(3)9(20-14)5-15(6,12)18/h8-12,16,18H,1-2,4-5H2,3H3/t8-,9+,10+,11-,12-,14+,15+/m0/s1 |
| InChIKey | AHTLNYYIAWQJGO-LMGGXVIJSA-N |
| XLogP | 0.31 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|