C15H16O5 — CID 155514648
(1R,3S,5S,6R,10S,11R)-5-hydroxy-3,12-dimethyl-7-methylidene-2,9-dioxatetracyclo[9.3.0.01,3.06,10]tetradec-12-ene-8,14-dione (PubChem CID 155514648) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is (1R,3S,5S,6R,10S,11R)-5-hydroxy-3,12-dimethyl-7-methylidene-2,9-dioxatetracyclo[9.3.0.01,3.06,10]tetradec-12-ene-8,14-dione.
| Compound Name | (1R,3S,5S,6R,10S,11R)-5-hydroxy-3,12-dimethyl-7-methylidene-2,9-dioxatetracyclo[9.3.0.01,3.06,10]tetradec-12-ene-8,14-dione |
|---|---|
| PubChem CID | 155514648 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (1R,3S,5S,6R,10S,11R)-5-hydroxy-3,12-dimethyl-7-methylidene-2,9-dioxatetracyclo[9.3.0.01,3.06,10]tetradec-12-ene-8,14-dione |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1[C@@H](O)C[C@]1(C)O[C@@]13C(=O)C=C(C)[C@H]23 |
| InChI | InChI=1S/C15H16O5/c1-6-4-9(17)15-11(6)12-10(7(2)13(18)19-12)8(16)5-14(15,3)20-15/h4,8,10-12,16H,2,5H2,1,3H3/t8-,10+,11+,12-,14-,15+/m0/s1 |
| InChIKey | DCROLXNYJNLEOX-CKMHZVKNSA-N |
| XLogP | 0.52 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|