C17H22O6 — CID 163003511
[(1R,2S,3S,7R,9R,10S,11S,12R,14S)-11-hydroxy-1,9-dimethyl-4-methylidene-5-oxo-6,13-dioxatetracyclo[8.4.0.03,7.012,14]tetradecan-2-yl] acetate (PubChem CID 163003511) has the molecular formula C17H22O6 and a molecular weight of 322.36 g/mol. Its IUPAC name is [(1R,2S,3S,7R,9R,10S,11S,12R,14S)-11-hydroxy-1,9-dimethyl-4-methylidene-5-oxo-6,13-dioxatetracyclo[8.4.0.03,7.012,14]tetradecan-2-yl] acetate.
| Compound Name | [(1R,2S,3S,7R,9R,10S,11S,12R,14S)-11-hydroxy-1,9-dimethyl-4-methylidene-5-oxo-6,13-dioxatetracyclo[8.4.0.03,7.012,14]tetradecan-2-yl] acetate |
|---|---|
| PubChem CID | 163003511 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | [(1R,2S,3S,7R,9R,10S,11S,12R,14S)-11-hydroxy-1,9-dimethyl-4-methylidene-5-oxo-6,13-dioxatetracyclo[8.4.0.03,7.012,14]tetradecan-2-yl] acetate |
| SMILES | C=C1C(=O)O[C@@H]2C[C@@H](C)[C@@H]3[C@H](O)[C@H]4O[C@H]4[C@@]3(C)[C@@H](OC(C)=O)[C@@H]12 |
| InChI | InChI=1S/C17H22O6/c1-6-5-9-10(7(2)16(20)22-9)14(21-8(3)18)17(4)11(6)12(19)13-15(17)23-13/h6,9-15,19H,2,5H2,1,3-4H3/t6-,9-,10+,11-,12+,13-,14+,15-,17-/m1/s1 |
| InChIKey | UBKAHVHWYYAPTL-SZXBBXOBSA-N |
| XLogP | 0.82 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|